C32H32N6O6S2 — CID 175821072
N-[1-[4-(methanesulfonamido)but-2-enoyl]piperidin-3-yl]-5-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175821072) has the molecular formula C32H32N6O6S2 and a molecular weight of 660.78 g/mol. Its IUPAC name is N-[1-[4-(methanesulfonamido)but-2-enoyl]piperidin-3-yl]-5-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[1-[4-(methanesulfonamido)but-2-enoyl]piperidin-3-yl]-5-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175821072 |
| Molecular Formula | C32H32N6O6S2 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | N-[1-[4-(methanesulfonamido)but-2-enoyl]piperidin-3-yl]-5-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2ccnc3sc(C(=O)NC4CCCN(C(=O)C=CCNS(C)(=O)=O)C4)c1c23 |
| InChI | InChI=1S/C32H32N6O6S2/c1-20-18-23(44-22-9-4-3-5-10-22)12-13-25(20)38-28-27-24(36-32(38)41)14-16-33-31(27)45-29(28)30(40)35-21-8-7-17-37(19-21)26(39)11-6-15-34-46(2,42)43/h3-6,9-14,16,18,21,34H,7-8,15,17,19H2,1-2H3,(H,35,40)(H,36,41) |
| InChIKey | RHQGSKXTZGWCIF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|