C27H32ClN5 — CID 175823730
5-(4-chlorophenyl)-N-[(1-cyclohexylpiperidin-3-yl)methyl]-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 175823730) has the molecular formula C27H32ClN5 and a molecular weight of 462.04 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(1-cyclohexylpiperidin-3-yl)methyl]-2-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 5-(4-chlorophenyl)-N-[(1-cyclohexylpiperidin-3-yl)methyl]-2-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 175823730 |
| Molecular Formula | C27H32ClN5 |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(1-cyclohexylpiperidin-3-yl)methyl]-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | Clc1ccc(-c2cnc(-c3cccnc3)nc2NCC2CCCN(C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C27H32ClN5/c28-23-12-10-21(11-13-23)25-18-31-26(22-7-4-14-29-17-22)32-27(25)30-16-20-6-5-15-33(19-20)24-8-2-1-3-9-24/h4,7,10-14,17-18,20,24H,1-3,5-6,8-9,15-16,19H2,(H,30,31,32) |
| InChIKey | UDFJSNNUJPOSNM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |