C23H26ClN5 — CID 175823739
5-(4-chlorophenyl)-N-[1-(1-methylpiperidin-4-yl)ethyl]-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 175823739) has the molecular formula C23H26ClN5 and a molecular weight of 407.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[1-(1-methylpiperidin-4-yl)ethyl]-2-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 5-(4-chlorophenyl)-N-[1-(1-methylpiperidin-4-yl)ethyl]-2-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 175823739 |
| Molecular Formula | C23H26ClN5 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[1-(1-methylpiperidin-4-yl)ethyl]-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | CC(Nc1nc(-c2cccnc2)ncc1-c1ccc(Cl)cc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C23H26ClN5/c1-16(17-9-12-29(2)13-10-17)27-23-21(18-5-7-20(24)8-6-18)15-26-22(28-23)19-4-3-11-25-14-19/h3-8,11,14-17H,9-10,12-13H2,1-2H3,(H,26,27,28) |
| InChIKey | NTTIUCLLYUKRJX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |