About 2-acetyloxyacetate;butan-1-olate;zirconium(2+)
2-acetyloxyacetate;butan-1-olate;zirconium(2+) (PubChem CID 175825436) has the molecular formula C8H14O5Zr
and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-acetyloxyacetate;butan-1-olate;zirconium(2+).
Molecular Properties
| Compound Name | 2-acetyloxyacetate;butan-1-olate;zirconium(2+) |
| PubChem CID | 175825436 |
| Molecular Formula | C8H14O5Zr |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-acetyloxyacetate;butan-1-olate;zirconium(2+) |
| SMILES | CC(=O)OCC(=O)[O-].CCCC[O-].[Zr+2] |
| InChI | InChI=1S/C4H6O4.C4H9O.Zr/c1-3(5)8-2-4(6)7;1-2-3-4-5;/h2H2,1H3,(H,6,7);2-4H2,1H3;/q;-1;+2/p-1 |
| InChIKey | CEWFQCDKBOPBRG-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-acetyloxyacetate;butan-1-olate;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyacetate;butan-1-olate;zirconium(2+)?
The IUPAC name of 2-acetyloxyacetate;butan-1-olate;zirconium(2+) (CID 175825436) is 2-acetyloxyacetate;butan-1-olate;zirconium(2+).
What is the SMILES notation for 2-acetyloxyacetate;butan-1-olate;zirconium(2+)?
The canonical SMILES for 2-acetyloxyacetate;butan-1-olate;zirconium(2+) is CC(=O)OCC(=O)[O-].CCCC[O-].[Zr+2].
What is the InChIKey of 2-acetyloxyacetate;butan-1-olate;zirconium(2+)?
The InChIKey is CEWFQCDKBOPBRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O4.C4H9O.Zr/c1-3(5)8-2-4(6)7;1-2-3-4-5;/h2H2,1H3,(H,6,7);2-4H2,1H3;/q;-1;+2/p-1.
What are the key properties of 2-acetyloxyacetate;butan-1-olate;zirconium(2+)?
2-acetyloxyacetate;butan-1-olate;zirconium(2+) has a molecular weight of 281.42 g/mol, XLogP of -1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyacetate;butan-1-olate;zirconium(2+) is sourced from PubChem (CID 175825436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).