C18H26ClN5O — CID 175826593
2-chloro-N-(3-methylbutyl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxamide (PubChem CID 175826593) has the molecular formula C18H26ClN5O and a molecular weight of 363.89 g/mol. Its IUPAC name is 2-chloro-N-(3-methylbutyl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxamide.
| Compound Name | 2-chloro-N-(3-methylbutyl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 175826593 |
| Molecular Formula | C18H26ClN5O |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-chloro-N-(3-methylbutyl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxamide |
| SMILES | CC(C)CCNC(=O)n1c(Cl)nc2c(N3CCN(C)CC3)cccc21 |
| InChI | InChI=1S/C18H26ClN5O/c1-13(2)7-8-20-18(25)24-15-6-4-5-14(16(15)21-17(24)19)23-11-9-22(3)10-12-23/h4-6,13H,7-12H2,1-3H3,(H,20,25) |
| InChIKey | CEPPKDLYXMUKSF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |