C21H32N6O — CID 175826611
4-[4-(1-methylazetidin-3-yl)piperazin-1-yl]-2-(3-methylbutyl)benzimidazole-1-carboxamide (PubChem CID 175826611) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is 4-[4-(1-methylazetidin-3-yl)piperazin-1-yl]-2-(3-methylbutyl)benzimidazole-1-carboxamide.
| Compound Name | 4-[4-(1-methylazetidin-3-yl)piperazin-1-yl]-2-(3-methylbutyl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 175826611 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 4-[4-(1-methylazetidin-3-yl)piperazin-1-yl]-2-(3-methylbutyl)benzimidazole-1-carboxamide |
| SMILES | CC(C)CCc1nc2c(N3CCN(C4CN(C)C4)CC3)cccc2n1C(N)=O |
| InChI | InChI=1S/C21H32N6O/c1-15(2)7-8-19-23-20-17(5-4-6-18(20)27(19)21(22)28)26-11-9-25(10-12-26)16-13-24(3)14-16/h4-6,15-16H,7-14H2,1-3H3,(H2,22,28) |
| InChIKey | RLNLOJQBLTUCJO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |