C23H31N5O — CID 156708090
4-(2-methyl-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl)-N-(4-methylpent-2-ynyl)benzimidazole-1-carboxamide (PubChem CID 156708090) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-(2-methyl-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl)-N-(4-methylpent-2-ynyl)benzimidazole-1-carboxamide.
| Compound Name | 4-(2-methyl-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl)-N-(4-methylpent-2-ynyl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 156708090 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 4-(2-methyl-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl)-N-(4-methylpent-2-ynyl)benzimidazole-1-carboxamide |
| SMILES | CC(C)C#CCNC(=O)n1cnc2c(N3CCC4CN(C)CC4CC3)cccc21 |
| InChI | InChI=1S/C23H31N5O/c1-17(2)6-5-11-24-23(29)28-16-25-22-20(7-4-8-21(22)28)27-12-9-18-14-26(3)15-19(18)10-13-27/h4,7-8,16-19H,9-15H2,1-3H3,(H,24,29) |
| InChIKey | ZXMVPFRPSWAARX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|