C32H51N3O8 — CID 175827563
2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-11,13-dioxo-N-phenyl-1-oxa-4-azacyclotridecane-4-carboxamide (PubChem CID 175827563) has the molecular formula C32H51N3O8 and a molecular weight of 605.77 g/mol. Its IUPAC name is 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-11,13-dioxo-N-phenyl-1-oxa-4-azacyclotridecane-4-carboxamide.
| Compound Name | 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-11,13-dioxo-N-phenyl-1-oxa-4-azacyclotridecane-4-carboxamide |
|---|---|
| PubChem CID | 175827563 |
| Molecular Formula | C32H51N3O8 |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-11,13-dioxo-N-phenyl-1-oxa-4-azacyclotridecane-4-carboxamide |
| SMILES | COC1(C)CC(C)CN(C(=O)Nc2ccccc2)CC(O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)OC(=O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C32H51N3O8/c1-20-16-32(6,40-9)17-21(2)27(37)31(4,5)29(38)43-25(42-28-26(36)24(34(7)8)15-22(3)41-28)19-35(18-20)30(39)33-23-13-11-10-12-14-23/h10-14,20-22,24-26,28,36H,15-19H2,1-9H3,(H,33,39)/t20?,21?,22-,24+,25?,26-,28+,32?/m1/s1 |
| InChIKey | ARTFGUFQNHDJPM-FQUQVGFRSA-N |
| XLogP | 3.90 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|