C28H52N2O7 — CID 175827532
2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-4-propyl-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 175827532) has the molecular formula C28H52N2O7 and a molecular weight of 528.73 g/mol. Its IUPAC name is 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-4-propyl-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-4-propyl-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 175827532 |
| Molecular Formula | C28H52N2O7 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12,12-pentamethyl-4-propyl-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CCCN1CC(C)CC(C)(OC)CC(C)C(=O)C(C)(C)C(=O)OC(O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)C1 |
| InChI | InChI=1S/C28H52N2O7/c1-11-12-30-16-18(2)14-28(7,34-10)15-19(3)24(32)27(5,6)26(33)37-22(17-30)36-25-23(31)21(29(8)9)13-20(4)35-25/h18-23,25,31H,11-17H2,1-10H3/t18?,19?,20-,21+,22?,23-,25+,28?/m1/s1 |
| InChIKey | OTZHZYHWMJBOHQ-LZEVEYIFSA-N |
| XLogP | 3.08 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|