C27H50N2O7 — CID 175827545
2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-4-ethyl-8-methoxy-6,8,10,12,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 175827545) has the molecular formula C27H50N2O7 and a molecular weight of 514.70 g/mol. Its IUPAC name is 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-4-ethyl-8-methoxy-6,8,10,12,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-4-ethyl-8-methoxy-6,8,10,12,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 175827545 |
| Molecular Formula | C27H50N2O7 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 2-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-4-ethyl-8-methoxy-6,8,10,12,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CCN1CC(C)CC(C)(OC)CC(C)C(=O)C(C)(C)C(=O)OC(O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)C1 |
| InChI | InChI=1S/C27H50N2O7/c1-11-29-15-17(2)13-27(7,33-10)14-18(3)23(31)26(5,6)25(32)36-21(16-29)35-24-22(30)20(28(8)9)12-19(4)34-24/h17-22,24,30H,11-16H2,1-10H3/t17?,18?,19-,20+,21?,22-,24+,27?/m1/s1 |
| InChIKey | HOOBUFXFUFPTFN-DPBCQHAUSA-N |
| XLogP | 2.69 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|