C35H41N3O5 — CID 175829193
butyl 4-[[4-benzyl-2-(4-methoxycarbonylphenyl)piperazin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylate (PubChem CID 175829193) has the molecular formula C35H41N3O5 and a molecular weight of 583.73 g/mol. Its IUPAC name is butyl 4-[[4-benzyl-2-(4-methoxycarbonylphenyl)piperazin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylate.
| Compound Name | butyl 4-[[4-benzyl-2-(4-methoxycarbonylphenyl)piperazin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 175829193 |
| Molecular Formula | C35H41N3O5 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | butyl 4-[[4-benzyl-2-(4-methoxycarbonylphenyl)piperazin-1-yl]methyl]-5-methoxy-7-methylindole-1-carboxylate |
| SMILES | CCCCOC(=O)n1ccc2c(CN3CCN(Cc4ccccc4)CC3c3ccc(C(=O)OC)cc3)c(OC)cc(C)c21 |
| InChI | InChI=1S/C35H41N3O5/c1-5-6-20-43-35(40)38-17-16-29-30(32(41-3)21-25(2)33(29)38)23-37-19-18-36(22-26-10-8-7-9-11-26)24-31(37)27-12-14-28(15-13-27)34(39)42-4/h7-17,21,31H,5-6,18-20,22-24H2,1-4H3 |
| InChIKey | VIYKLQVQXQILEP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|