C28H33N3O3 — CID 175628010
methyl 4-[(2S,4S,6S)-8-[(5-methoxy-1,7-dimethylindol-4-yl)methyl]-1,8-diazatricyclo[4.4.0.02,4]decan-9-yl]benzoate (PubChem CID 175628010) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl 4-[(2S,4S,6S)-8-[(5-methoxy-1,7-dimethylindol-4-yl)methyl]-1,8-diazatricyclo[4.4.0.02,4]decan-9-yl]benzoate.
| Compound Name | methyl 4-[(2S,4S,6S)-8-[(5-methoxy-1,7-dimethylindol-4-yl)methyl]-1,8-diazatricyclo[4.4.0.02,4]decan-9-yl]benzoate |
|---|---|
| PubChem CID | 175628010 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | methyl 4-[(2S,4S,6S)-8-[(5-methoxy-1,7-dimethylindol-4-yl)methyl]-1,8-diazatricyclo[4.4.0.02,4]decan-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CN3[C@@H](C[C@@H]4C[C@@H]43)CN2Cc2c(OC)cc(C)c3c2ccn3C)cc1 |
| InChI | InChI=1S/C28H33N3O3/c1-17-11-26(33-3)23(22-9-10-29(2)27(17)22)15-30-14-21-12-20-13-24(20)31(21)16-25(30)18-5-7-19(8-6-18)28(32)34-4/h5-11,20-21,24-25H,12-16H2,1-4H3/t20-,21+,24+,25?/m1/s1 |
| InChIKey | QJHOKAOLOSMKCT-SNSIXXDBSA-N |
| XLogP | 4.30 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |