C34H39N3O5S — CID 175628109
methyl 4-[(6R,8aS)-2-[[5-methoxy-7-methyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-6-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]benzoate (PubChem CID 175628109) has the molecular formula C34H39N3O5S and a molecular weight of 601.77 g/mol. Its IUPAC name is methyl 4-[(6R,8aS)-2-[[5-methoxy-7-methyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-6-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]benzoate.
| Compound Name | methyl 4-[(6R,8aS)-2-[[5-methoxy-7-methyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-6-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]benzoate |
|---|---|
| PubChem CID | 175628109 |
| Molecular Formula | C34H39N3O5S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | methyl 4-[(6R,8aS)-2-[[5-methoxy-7-methyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-6-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CN3[C@@H](CC[C@H]3C)CN2Cc2c(OC)cc(C)c3c2ccn3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H39N3O5S/c1-22-6-14-28(15-7-22)43(39,40)37-17-16-29-30(32(41-4)18-23(2)33(29)37)20-35-19-27-13-8-24(3)36(27)21-31(35)25-9-11-26(12-10-25)34(38)42-5/h6-7,9-12,14-18,24,27,31H,8,13,19-21H2,1-5H3/t24-,27+,31?/m1/s1 |
| InChIKey | FJOODVAKEMKBMQ-VPEYYILGSA-N |
| XLogP | 5.70 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |