C57H77FGaN11O14Si- — CID 175833161
CID 175833161 (PubChem CID 175833161) has the molecular formula C57H77FGaN11O14Si- and a molecular weight of 1257.11 g/mol.
| Compound Name | CID 175833161 |
|---|---|
| PubChem CID | 175833161 |
| Molecular Formula | C57H77FGaN11O14Si- |
| Molecular Weight | 1257.11 g/mol |
| Exact Mass | 1255.47 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](F)(c1ccc(C(=O)NC[C@@H](NC(=O)CC[C@H](C(=O)O)N2CCN3CCN(CC(=O)[O-])CCN(CC2)CC(=O)OOC(=O)C3)C(=O)NCCCOc2ccc3nccc(C(=O)NCC(=O)N4CCC[C@H]4C#N)c3c2)cc1)C(C)(C)C.[Ga] |
| InChI | InChI=1S/C57H78FN11O14Si.Ga/c1-56(2,3)84(58,57(4,5)6)41-13-10-38(11-14-41)52(76)62-33-45(54(78)61-19-8-30-81-40-12-15-44-43(31-40)42(18-20-60-44)53(77)63-34-48(71)69-21-7-9-39(69)32-59)64-47(70)17-16-46(55(79)80)68-28-26-66-24-22-65(35-49(72)73)23-25-67(27-29-68)37-51(75)83-82-50(74)36-66;/h10-15,18,20,31,39,45-46H,7-9,16-17,19,21-30,33-37H2,1-6H3,(H,61,78)(H,62,76)(H,63,77)(H,64,70)(H,72,73)(H,79,80);/p-1/t39-,45+,46+;/m0./s1 |
| InChIKey | TXJLFEGIROYHIJ-UHVUNMRASA-M |
| XLogP | -0.16 |
| TPSA | 325.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1257.11 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|