C37H49FN8O5Si — CID 175582066
6-[3-[[2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]propoxy]-N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]quinazoline-4-carboxamide (PubChem CID 175582066) has the molecular formula C37H49FN8O5Si and a molecular weight of 732.93 g/mol. Its IUPAC name is 6-[3-[[2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]propoxy]-N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]quinazoline-4-carboxamide.
| Compound Name | 6-[3-[[2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]propoxy]-N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 175582066 |
| Molecular Formula | C37H49FN8O5Si |
| Molecular Weight | 732.93 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | 6-[3-[[2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]propoxy]-N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]quinazoline-4-carboxamide |
| SMILES | CC(C)(C)[Si](F)(c1ccc(C(=O)NCC(N)C(=O)NCCCOc2ccc3ncnc(C(=O)NCC(=O)N4CCCC4C#N)c3c2)cc1)C(C)(C)C |
| InChI | InChI=1S/C37H49FN8O5Si/c1-36(2,3)52(38,37(4,5)6)27-13-10-24(11-14-27)33(48)42-21-29(40)34(49)41-16-8-18-51-26-12-15-30-28(19-26)32(45-23-44-30)35(50)43-22-31(47)46-17-7-9-25(46)20-39/h10-15,19,23,25,29H,7-9,16-18,21-22,40H2,1-6H3,(H,41,49)(H,42,48)(H,43,50) |
| InChIKey | BIGRPTAFUSGGML-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|