C7H11F3N2O3S — CID 175836971
1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine-3-carboxamide (PubChem CID 175836971) has the molecular formula C7H11F3N2O3S and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 175836971 |
| Molecular Formula | C7H11F3N2O3S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3N2O3S/c8-7(9,10)4-16(14,15)12-2-1-5(3-12)6(11)13/h5H,1-4H2,(H2,11,13) |
| InChIKey | NACQEOSDKYRIFY-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |