C16H19F2NO3S — CID 175838014
2-methylsulfanylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate (PubChem CID 175838014) has the molecular formula C16H19F2NO3S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate.
| Compound Name | 2-methylsulfanylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 175838014 |
| Molecular Formula | C16H19F2NO3S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-methylsulfanylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate |
| SMILES | CSCCOC(=O)CC1CCC(=O)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C16H19F2NO3S/c1-23-8-7-22-15(21)9-12-5-6-14(20)19(12)10-11-3-2-4-13(17)16(11)18/h2-4,12H,5-10H2,1H3 |
| InChIKey | MXROTTSFHSZYFH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|