C21H21N5O2 — CID 175840092
2-(3-pyridin-4-ylbenzimidazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 175840092) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-(3-pyridin-4-ylbenzimidazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 2-(3-pyridin-4-ylbenzimidazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 175840092 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(3-pyridin-4-ylbenzimidazole-5-carbonyl)-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C(c1ccc2ncn(-c3ccncc3)c2c1)N1CCC2(CCNCC2)C1=O |
| InChI | InChI=1S/C21H21N5O2/c27-19(25-12-7-21(20(25)28)5-10-23-11-6-21)15-1-2-17-18(13-15)26(14-24-17)16-3-8-22-9-4-16/h1-4,8-9,13-14,23H,5-7,10-12H2 |
| InChIKey | UNYWYLAWGQGZGC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|