C20H21BrFIN4O4S — CID 175843142
butyl 5-[(7-bromo-8-fluoro-6-iodo-2-methylsulfanyl-3-nitroquinolin-4-yl)amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 175843142) has the molecular formula C20H21BrFIN4O4S and a molecular weight of 639.28 g/mol. Its IUPAC name is butyl 5-[(7-bromo-8-fluoro-6-iodo-2-methylsulfanyl-3-nitroquinolin-4-yl)amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | butyl 5-[(7-bromo-8-fluoro-6-iodo-2-methylsulfanyl-3-nitroquinolin-4-yl)amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 175843142 |
| Molecular Formula | C20H21BrFIN4O4S |
| Molecular Weight | 639.28 g/mol |
| Exact Mass | 637.95 |
| IUPAC Name | butyl 5-[(7-bromo-8-fluoro-6-iodo-2-methylsulfanyl-3-nitroquinolin-4-yl)amino]-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | CCCCOC(=O)N1CC2CC1C2Nc1c([N+](=O)[O-])c(SC)nc2c(F)c(Br)c(I)cc12 |
| InChI | InChI=1S/C20H21BrFIN4O4S/c1-3-4-5-31-20(28)26-8-9-6-12(26)15(9)24-17-10-7-11(23)13(21)14(22)16(10)25-19(32-2)18(17)27(29)30/h7,9,12,15H,3-6,8H2,1-2H3,(H,24,25) |
| InChIKey | OMVJNBKVJUTKJU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.28 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|