C28H28N2O4 — CID 175844389
phenyl 2,6-diisocyanatohexanoate;2-phenylethylbenzene (PubChem CID 175844389) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is phenyl 2,6-diisocyanatohexanoate;2-phenylethylbenzene.
| Compound Name | phenyl 2,6-diisocyanatohexanoate;2-phenylethylbenzene |
|---|---|
| PubChem CID | 175844389 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | phenyl 2,6-diisocyanatohexanoate;2-phenylethylbenzene |
| SMILES | O=C=NCCCCC(N=C=O)C(=O)Oc1ccccc1.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14N2O4.C14H14/c17-10-15-9-5-4-8-13(16-11-18)14(19)20-12-6-2-1-3-7-12;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-3,6-7,13H,4-5,8-9H2;1-10H,11-12H2 |
| InChIKey | QEDCOPMGZKBXCY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|