About (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate
(3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate (PubChem CID 149103130) has the molecular formula C17H18N2O6
and a molecular weight of 346.34 g/mol. Its IUPAC name is (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate.
Molecular Properties
| Compound Name | (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate |
| PubChem CID | 149103130 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate |
| SMILES | N#COCCCCC(N=C=O)C(=O)OCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H18N2O6/c18-12-23-10-5-4-8-15(19-13-20)17(22)24-11-9-16(21)25-14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-11H2 |
| InChIKey | QVAGNZOAJFZRKA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 115.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate?
The IUPAC name of (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate (CID 149103130) is (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate.
What is the SMILES notation for (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate?
The canonical SMILES for (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate is N#COCCCCC(N=C=O)C(=O)OCCC(=O)Oc1ccccc1.
What is the InChIKey of (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate?
The InChIKey is QVAGNZOAJFZRKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O6/c18-12-23-10-5-4-8-15(19-13-20)17(22)24-11-9-16(21)25-14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-11H2.
What are the key properties of (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate?
(3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate has a molecular weight of 346.34 g/mol, XLogP of 1.90, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenoxypropyl) 6-cyanato-2-isocyanatohexanoate is sourced from PubChem (CID 149103130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).