C14H25N5O5 — CID 175845364
(2S)-5-(carbamoylamino)-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid (PubChem CID 175845364) has the molecular formula C14H25N5O5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175845364 |
| Molecular Formula | C14H25N5O5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C14H25N5O5/c1-8(18-12(21)9-4-2-6-16-9)11(20)19-10(13(22)23)5-3-7-17-14(15)24/h8-10,16H,2-7H2,1H3,(H,18,21)(H,19,20)(H,22,23)(H3,15,17,24)/t8-,9-,10-/m0/s1 |
| InChIKey | FGAJPBFDCUABFH-GUBZILKMSA-N |
| XLogP | -1.74 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|