C20H30N2O7 — CID 175845735
[2-acetyloxy-4-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxymethyl]amino]ethyl]carbamoyl]oxyphenyl] acetate (PubChem CID 175845735) has the molecular formula C20H30N2O7 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-acetyloxy-4-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxymethyl]amino]ethyl]carbamoyl]oxyphenyl] acetate.
| Compound Name | [2-acetyloxy-4-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxymethyl]amino]ethyl]carbamoyl]oxyphenyl] acetate |
|---|---|
| PubChem CID | 175845735 |
| Molecular Formula | C20H30N2O7 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [2-acetyloxy-4-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxymethyl]amino]ethyl]carbamoyl]oxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(OC(=O)N(C)CCN(C)COC(C)(C)C)cc1OC(C)=O |
| InChI | InChI=1S/C20H30N2O7/c1-14(23)27-17-9-8-16(12-18(17)28-15(2)24)29-19(25)22(7)11-10-21(6)13-26-20(3,4)5/h8-9,12H,10-11,13H2,1-7H3 |
| InChIKey | DJPFAOIZWCEWLZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|