C47H46BrN4O8PS — CID 175845782
6-[2-[(2-cyano-1,3-benzothiazol-6-yl)oxycarbonyl-methylamino]ethyl-(3,4-diacetyloxyphenoxy)carbonylamino]hexyl-triphenylphosphanium bromide (PubChem CID 175845782) has the molecular formula C47H46BrN4O8PS and a molecular weight of 937.85 g/mol. Its IUPAC name is 6-[2-[(2-cyano-1,3-benzothiazol-6-yl)oxycarbonyl-methylamino]ethyl-(3,4-diacetyloxyphenoxy)carbonylamino]hexyl-triphenylphosphanium bromide.
| Compound Name | 6-[2-[(2-cyano-1,3-benzothiazol-6-yl)oxycarbonyl-methylamino]ethyl-(3,4-diacetyloxyphenoxy)carbonylamino]hexyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 175845782 |
| Molecular Formula | C47H46BrN4O8PS |
| Molecular Weight | 937.85 g/mol |
| Exact Mass | 936.20 |
| IUPAC Name | 6-[2-[(2-cyano-1,3-benzothiazol-6-yl)oxycarbonyl-methylamino]ethyl-(3,4-diacetyloxyphenoxy)carbonylamino]hexyl-triphenylphosphanium bromide |
| SMILES | CC(=O)Oc1ccc(OC(=O)N(CCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN(C)C(=O)Oc2ccc3nc(C#N)sc3c2)cc1OC(C)=O.[Br-] |
| InChI | InChI=1S/C47H46N4O8PS.BrH/c1-34(52)56-42-26-24-36(31-43(42)57-35(2)53)59-47(55)51(29-28-50(3)46(54)58-37-23-25-41-44(32-37)61-45(33-48)49-41)27-15-4-5-16-30-60(38-17-9-6-10-18-38,39-19-11-7-12-20-39)40-21-13-8-14-22-40;/h6-14,17-26,31-32H,4-5,15-16,27-30H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PBTQMHFCTYYBJD-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 148.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.85 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|