C12H12BrF4N3O2S — CID 175848194
(2S,4R)-N-(6-bromo-2-pyridinyl)-4-fluoropyrrolidine-2-carbothioamide;2,2,2-trifluoroacetic acid (PubChem CID 175848194) has the molecular formula C12H12BrF4N3O2S and a molecular weight of 418.21 g/mol. Its IUPAC name is (2S,4R)-N-(6-bromo-2-pyridinyl)-4-fluoropyrrolidine-2-carbothioamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,4R)-N-(6-bromo-2-pyridinyl)-4-fluoropyrrolidine-2-carbothioamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175848194 |
| Molecular Formula | C12H12BrF4N3O2S |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | (2S,4R)-N-(6-bromo-2-pyridinyl)-4-fluoropyrrolidine-2-carbothioamide;2,2,2-trifluoroacetic acid |
| SMILES | F[C@H]1CN[C@H](C(=S)Nc2cccc(Br)n2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H11BrFN3S.C2HF3O2/c11-8-2-1-3-9(14-8)15-10(16)7-4-6(12)5-13-7;3-2(4,5)1(6)7/h1-3,6-7,13H,4-5H2,(H,14,15,16);(H,6,7)/t6-,7+;/m1./s1 |
| InChIKey | CPPDLESRJWSPOJ-HHQFNNIRSA-N |
| XLogP | 2.92 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|