C23H19F2N3O4 — CID 175849226
[5-(3-amino-2-methylanilino)furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone (PubChem CID 175849226) has the molecular formula C23H19F2N3O4 and a molecular weight of 439.42 g/mol. Its IUPAC name is [5-(3-amino-2-methylanilino)furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone.
| Compound Name | [5-(3-amino-2-methylanilino)furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 175849226 |
| Molecular Formula | C23H19F2N3O4 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | [5-(3-amino-2-methylanilino)furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(F)c(C(=O)c2cc3cc(Nc4cccc(N)c4C)ncc3o2)c1F |
| InChI | InChI=1S/C23H19F2N3O4/c1-11-13(26)5-4-6-14(11)28-19-8-12-7-17(32-18(12)10-27-19)23(29)20-21(24)15(30-2)9-16(31-3)22(20)25/h4-10H,26H2,1-3H3,(H,27,28) |
| InChIKey | QWFGHHJAKKFPET-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|