C21H20N2O — CID 175851298
10,10-dimethyl-8-phenyl-11,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraen-12-one (PubChem CID 175851298) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is 10,10-dimethyl-8-phenyl-11,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraen-12-one.
| Compound Name | 10,10-dimethyl-8-phenyl-11,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 175851298 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 10,10-dimethyl-8-phenyl-11,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraen-12-one |
| SMILES | CC1(C)C2=C(c3ccccc3)c3ccccc3C2N2CCC(=O)N21 |
| InChI | InChI=1S/C21H20N2O/c1-21(2)19-18(14-8-4-3-5-9-14)15-10-6-7-11-16(15)20(19)22-13-12-17(24)23(21)22/h3-11,20H,12-13H2,1-2H3 |
| InChIKey | AGWVBWRVRBTCTK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |