C11H8ClN3 — CID 175852017
5-chloro-1-pyridin-3-yl-6H-pyrrolo[2,3-b]pyrrole (PubChem CID 175852017) has the molecular formula C11H8ClN3 and a molecular weight of 217.66 g/mol. Its IUPAC name is 5-chloro-1-pyridin-3-yl-6H-pyrrolo[2,3-b]pyrrole.
| Compound Name | 5-chloro-1-pyridin-3-yl-6H-pyrrolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 175852017 |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-chloro-1-pyridin-3-yl-6H-pyrrolo[2,3-b]pyrrole |
| SMILES | Clc1cc2ccn(-c3cccnc3)c2[nH]1 |
| InChI | InChI=1S/C11H8ClN3/c12-10-6-8-3-5-15(11(8)14-10)9-2-1-4-13-7-9/h1-7,14H |
| InChIKey | NEVGROGBDXMKFG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |