C11H14FNO4S2 — CID 175852123
2-(pyrrolidin-1-ylsulfonylmethyl)benzenesulfonyl fluoride (PubChem CID 175852123) has the molecular formula C11H14FNO4S2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-(pyrrolidin-1-ylsulfonylmethyl)benzenesulfonyl fluoride.
| Compound Name | 2-(pyrrolidin-1-ylsulfonylmethyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 175852123 |
| Molecular Formula | C11H14FNO4S2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-(pyrrolidin-1-ylsulfonylmethyl)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccccc1CS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C11H14FNO4S2/c12-19(16,17)11-6-2-1-5-10(11)9-18(14,15)13-7-3-4-8-13/h1-2,5-6H,3-4,7-9H2 |
| InChIKey | IKPAUDVMSANXSG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |