C28H28N2O4S — CID 175854868
bis(1-[(4-ethenylphenyl)methyl]pyridin-1-ium);sulfate (PubChem CID 175854868) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is bis(1-[(4-ethenylphenyl)methyl]pyridin-1-ium);sulfate.
| Compound Name | bis(1-[(4-ethenylphenyl)methyl]pyridin-1-ium);sulfate |
|---|---|
| PubChem CID | 175854868 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | bis(1-[(4-ethenylphenyl)methyl]pyridin-1-ium);sulfate |
| SMILES | C=Cc1ccc(C[n+]2ccccc2)cc1.C=Cc1ccc(C[n+]2ccccc2)cc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C14H14N.H2O4S/c2*1-2-13-6-8-14(9-7-13)12-15-10-4-3-5-11-15;1-5(2,3)4/h2*2-11H,1,12H2;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | AQQBAEPTGMTGOB-UHFFFAOYSA-L |
| XLogP | 3.99 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|