C16H18N2O4 — CID 175820447
2-[3-[(4-ethenylphenyl)methyl]imidazol-3-ium-1-yl]acetic acid acetate (PubChem CID 175820447) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[3-[(4-ethenylphenyl)methyl]imidazol-3-ium-1-yl]acetic acid acetate.
| Compound Name | 2-[3-[(4-ethenylphenyl)methyl]imidazol-3-ium-1-yl]acetic acid acetate |
|---|---|
| PubChem CID | 175820447 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-[3-[(4-ethenylphenyl)methyl]imidazol-3-ium-1-yl]acetic acid acetate |
| SMILES | C=Cc1ccc(C[n+]2ccn(CC(=O)O)c2)cc1.CC(=O)[O-] |
| InChI | InChI=1S/C14H14N2O2.C2H4O2/c1-2-12-3-5-13(6-4-12)9-15-7-8-16(11-15)10-14(17)18;1-2(3)4/h2-8,11H,1,9-10H2;1H3,(H,3,4) |
| InChIKey | LNQOKXATMIZWFT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|