C17H26N2O6 — CID 175855229
tert-butyl (1R,5S)-6-[(E)-C-(4-ethoxy-3,4-dioxobutan-2-yl)-N-hydroxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 175855229) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is tert-butyl (1R,5S)-6-[(E)-C-(4-ethoxy-3,4-dioxobutan-2-yl)-N-hydroxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (1R,5S)-6-[(E)-C-(4-ethoxy-3,4-dioxobutan-2-yl)-N-hydroxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 175855229 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | tert-butyl (1R,5S)-6-[(E)-C-(4-ethoxy-3,4-dioxobutan-2-yl)-N-hydroxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CCOC(=O)C(=O)C(C)/C(=N/O)C1[C@H]2CN(C(=O)OC(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C17H26N2O6/c1-6-24-15(21)14(20)9(2)13(18-23)12-10-7-19(8-11(10)12)16(22)25-17(3,4)5/h9-12,23H,6-8H2,1-5H3/b18-13-/t9?,10-,11+,12? |
| InChIKey | WBYTWIKLQOJOSA-HGCLSYLBSA-N |
| XLogP | 1.70 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|