C17H28N2O4 — CID 19365045
tert-butyl 4-(1-amino-2-ethoxy-2-oxoethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate (PubChem CID 19365045) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl 4-(1-amino-2-ethoxy-2-oxoethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 4-(1-amino-2-ethoxy-2-oxoethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 19365045 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl 4-(1-amino-2-ethoxy-2-oxoethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
| SMILES | CCOC(=O)C(N)C1CC=CC2CN(C(=O)OC(C)(C)C)CC21 |
| InChI | InChI=1S/C17H28N2O4/c1-5-22-15(20)14(18)12-8-6-7-11-9-19(10-13(11)12)16(21)23-17(2,3)4/h6-7,11-14H,5,8-10,18H2,1-4H3 |
| InChIKey | STHWHZBPTPSHRG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|