C14H21NO5 — CID 70301309
tert-butyl 4-carboxyoxy-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate (PubChem CID 70301309) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl 4-carboxyoxy-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 4-carboxyoxy-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 70301309 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl 4-carboxyoxy-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C=CCC(OC(=O)O)C2C1 |
| InChI | InChI=1S/C14H21NO5/c1-14(2,3)20-12(16)15-7-9-5-4-6-11(10(9)8-15)19-13(17)18/h4-5,9-11H,6-8H2,1-3H3,(H,17,18) |
| InChIKey | ATXHTQPYGGEZEK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|