C33H33FN6O4S — CID 175855649
ethyl (2R,3R)-3-[[6-ethenyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 175855649) has the molecular formula C33H33FN6O4S and a molecular weight of 628.73 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[[6-ethenyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-[[6-ethenyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 175855649 |
| Molecular Formula | C33H33FN6O4S |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | ethyl (2R,3R)-3-[[6-ethenyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | C=Cc1cc2c(N[C@@H]3C4CCC(CC4)[C@H]3C(=O)OCC)nc(-c3cn(S(=O)(=O)c4ccc(C)cc4)c4ncc(F)cc34)nn2c1 |
| InChI | InChI=1S/C33H33FN6O4S/c1-4-20-14-27-31(36-29-22-10-8-21(9-11-22)28(29)33(41)44-5-2)37-30(38-39(27)17-20)26-18-40(32-25(26)15-23(34)16-35-32)45(42,43)24-12-6-19(3)7-13-24/h4,6-7,12-18,21-22,28-29H,1,5,8-11H2,2-3H3,(H,36,37,38)/t21?,22?,28-,29-/m1/s1 |
| InChIKey | IZLWOZYBKOKIJG-YHKYUMDGSA-N |
| XLogP | 5.85 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |