C31H30ClFN6O4S — CID 175855661
ethyl (2R,3R)-3-[[5-chloro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 175855661) has the molecular formula C31H30ClFN6O4S and a molecular weight of 637.14 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[[5-chloro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-[[5-chloro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 175855661 |
| Molecular Formula | C31H30ClFN6O4S |
| Molecular Weight | 637.14 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | ethyl (2R,3R)-3-[[5-chloro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2CCC(CC2)[C@H]1Nc1nc(-c2cn(S(=O)(=O)c3ccc(C)cc3)c3ncc(F)cc23)nn2ccc(Cl)c12 |
| InChI | InChI=1S/C31H30ClFN6O4S/c1-3-43-31(40)25-18-6-8-19(9-7-18)26(25)35-29-27-24(32)12-13-38(27)37-28(36-29)23-16-39(30-22(23)14-20(33)15-34-30)44(41,42)21-10-4-17(2)5-11-21/h4-5,10-16,18-19,25-26H,3,6-9H2,1-2H3,(H,35,36,37)/t18?,19?,25-,26-/m1/s1 |
| InChIKey | ZRCZLTUEOMCXHA-FZDRZVJHSA-N |
| XLogP | 5.86 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.14 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |