C11H8F6 — CID 175858113
1-cyclopropyl-2,3-bis(trifluoromethyl)benzene (PubChem CID 175858113) has the molecular formula C11H8F6 and a molecular weight of 254.17 g/mol. Its IUPAC name is 1-cyclopropyl-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-cyclopropyl-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175858113 |
| Molecular Formula | C11H8F6 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-cyclopropyl-2,3-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(C2CC2)c1C(F)(F)F |
| InChI | InChI=1S/C11H8F6/c12-10(13,14)8-3-1-2-7(6-4-5-6)9(8)11(15,16)17/h1-3,6H,4-5H2 |
| InChIKey | RGMUORWSTKFRJE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |