C20H18N4OS — CID 175860712
2-[(1S)-1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 175860712) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-[(1S)-1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenol.
| Compound Name | 2-[(1S)-1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 175860712 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-[(1S)-1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Cc1nc(N[C@@H](C)c2ccccc2O)cc(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C20H18N4OS/c1-12(15-5-3-4-6-18(15)25)22-20-10-17(23-13(2)24-20)14-7-8-16-19(9-14)26-11-21-16/h3-12,25H,1-2H3,(H,22,23,24)/t12-/m0/s1 |
| InChIKey | GQGJULNKDOOHBG-LBPRGKRZSA-N |
| XLogP | 4.94 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|