C22H30O2S — CID 175864978
3-tert-butyl-5-(3-tert-butyl-5-hydroxy-2-methylphenyl)sulfanyl-4-methylphenol (PubChem CID 175864978) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is 3-tert-butyl-5-(3-tert-butyl-5-hydroxy-2-methylphenyl)sulfanyl-4-methylphenol.
| Compound Name | 3-tert-butyl-5-(3-tert-butyl-5-hydroxy-2-methylphenyl)sulfanyl-4-methylphenol |
|---|---|
| PubChem CID | 175864978 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 3-tert-butyl-5-(3-tert-butyl-5-hydroxy-2-methylphenyl)sulfanyl-4-methylphenol |
| SMILES | Cc1c(Sc2cc(O)cc(C(C)(C)C)c2C)cc(O)cc1C(C)(C)C |
| InChI | InChI=1S/C22H30O2S/c1-13-17(21(3,4)5)9-15(23)11-19(13)25-20-12-16(24)10-18(14(20)2)22(6,7)8/h9-12,23-24H,1-8H3 |
| InChIKey | ZGDWOZCDGBMCKX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |