C14H18F3N3O6 — CID 175868831
N-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 175868831) has the molecular formula C14H18F3N3O6 and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175868831 |
| Molecular Formula | C14H18F3N3O6 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC(=O)NCCNC(=O)CN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3O4.C2HF3O2/c1-2-3-9(16)13-6-7-14-10(17)8-15-11(18)4-5-12(15)19;3-2(4,5)1(6)7/h4-5H,2-3,6-8H2,1H3,(H,13,16)(H,14,17);(H,6,7) |
| InChIKey | BPDKYRFEHRLNRI-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|