C41H27N5Se2 — CID 175869265
[3-[2-(5,6-diphenyltriazin-4-yl)phenyl]-4-(2-phenylphenyl)selenophen-2-yl]-selenophen-2-yldiazene (PubChem CID 175869265) has the molecular formula C41H27N5Se2 and a molecular weight of 747.62 g/mol. Its IUPAC name is [3-[2-(5,6-diphenyltriazin-4-yl)phenyl]-4-(2-phenylphenyl)selenophen-2-yl]-selenophen-2-yldiazene.
| Compound Name | [3-[2-(5,6-diphenyltriazin-4-yl)phenyl]-4-(2-phenylphenyl)selenophen-2-yl]-selenophen-2-yldiazene |
|---|---|
| PubChem CID | 175869265 |
| Molecular Formula | C41H27N5Se2 |
| Molecular Weight | 747.62 g/mol |
| Exact Mass | 749.06 |
| IUPAC Name | [3-[2-(5,6-diphenyltriazin-4-yl)phenyl]-4-(2-phenylphenyl)selenophen-2-yl]-selenophen-2-yldiazene |
| SMILES | c1ccc(-c2ccccc2-c2c[se]c(N=Nc3ccc[se]3)c2-c2ccccc2-c2nnnc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H27N5Se2/c1-4-15-28(16-5-1)31-21-10-11-22-32(31)35-27-48-41(45-42-36-25-14-26-47-36)38(35)33-23-12-13-24-34(33)40-37(29-17-6-2-7-18-29)39(43-46-44-40)30-19-8-3-9-20-30/h1-27H |
| InChIKey | RNJACXVXAOZEJI-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.62 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|