C18H34F3N3O4 — CID 175870096
N-[(2R)-2-amino-3-(hexylamino)-3-oxopropyl]heptanamide;2,2,2-trifluoroacetic acid (PubChem CID 175870096) has the molecular formula C18H34F3N3O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[(2R)-2-amino-3-(hexylamino)-3-oxopropyl]heptanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2R)-2-amino-3-(hexylamino)-3-oxopropyl]heptanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175870096 |
| Molecular Formula | C18H34F3N3O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-[(2R)-2-amino-3-(hexylamino)-3-oxopropyl]heptanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCNC(=O)[C@H](N)CNC(=O)CCCCCC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H33N3O2.C2HF3O2/c1-3-5-7-9-11-15(20)19-13-14(17)16(21)18-12-10-8-6-4-2;3-2(4,5)1(6)7/h14H,3-13,17H2,1-2H3,(H,18,21)(H,19,20);(H,6,7)/t14-;/m1./s1 |
| InChIKey | WCZBSTREYYKKCO-PFEQFJNWSA-N |
| XLogP | 2.73 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|