C20H27F3N4O5 — CID 175870109
methyl 2-[(2S)-2-amino-3-(hexylamino)-3-oxopropyl]imidazo[1,2-a]pyridine-7-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 175870109) has the molecular formula C20H27F3N4O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is methyl 2-[(2S)-2-amino-3-(hexylamino)-3-oxopropyl]imidazo[1,2-a]pyridine-7-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[(2S)-2-amino-3-(hexylamino)-3-oxopropyl]imidazo[1,2-a]pyridine-7-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175870109 |
| Molecular Formula | C20H27F3N4O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | methyl 2-[(2S)-2-amino-3-(hexylamino)-3-oxopropyl]imidazo[1,2-a]pyridine-7-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCNC(=O)[C@@H](N)Cc1cn2ccc(C(=O)OC)cc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O3.C2HF3O2/c1-3-4-5-6-8-20-17(23)15(19)11-14-12-22-9-7-13(18(24)25-2)10-16(22)21-14;3-2(4,5)1(6)7/h7,9-10,12,15H,3-6,8,11,19H2,1-2H3,(H,20,23);(H,6,7)/t15-;/m0./s1 |
| InChIKey | CREPLZZTMBVDRN-RSAXXLAASA-N |
| XLogP | 2.32 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|