C7H9ClF3O4P — CID 175871020
2-[[chloro(prop-2-enoxy)phosphoryl]peroxymethyl]-3,3,3-trifluoroprop-1-ene (PubChem CID 175871020) has the molecular formula C7H9ClF3O4P and a molecular weight of 280.57 g/mol. Its IUPAC name is 2-[[chloro(prop-2-enoxy)phosphoryl]peroxymethyl]-3,3,3-trifluoroprop-1-ene.
| Compound Name | 2-[[chloro(prop-2-enoxy)phosphoryl]peroxymethyl]-3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 175871020 |
| Molecular Formula | C7H9ClF3O4P |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-[[chloro(prop-2-enoxy)phosphoryl]peroxymethyl]-3,3,3-trifluoroprop-1-ene |
| SMILES | C=CCOP(=O)(Cl)OOCC(=C)C(F)(F)F |
| InChI | InChI=1S/C7H9ClF3O4P/c1-3-4-14-16(8,12)15-13-5-6(2)7(9,10)11/h3H,1-2,4-5H2 |
| InChIKey | KRALLHZSQTXMKV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|