C20H16Br2O4 — CID 175871475
2-(3,4-dibromophenyl)-3-hydroxy-7-(3-methylbut-3-enoxy)chromen-4-one (PubChem CID 175871475) has the molecular formula C20H16Br2O4 and a molecular weight of 480.15 g/mol. Its IUPAC name is 2-(3,4-dibromophenyl)-3-hydroxy-7-(3-methylbut-3-enoxy)chromen-4-one.
| Compound Name | 2-(3,4-dibromophenyl)-3-hydroxy-7-(3-methylbut-3-enoxy)chromen-4-one |
|---|---|
| PubChem CID | 175871475 |
| Molecular Formula | C20H16Br2O4 |
| Molecular Weight | 480.15 g/mol |
| Exact Mass | 477.94 |
| IUPAC Name | 2-(3,4-dibromophenyl)-3-hydroxy-7-(3-methylbut-3-enoxy)chromen-4-one |
| SMILES | C=C(C)CCOc1ccc2c(=O)c(O)c(-c3ccc(Br)c(Br)c3)oc2c1 |
| InChI | InChI=1S/C20H16Br2O4/c1-11(2)7-8-25-13-4-5-14-17(10-13)26-20(19(24)18(14)23)12-3-6-15(21)16(22)9-12/h3-6,9-10,24H,1,7-8H2,2H3 |
| InChIKey | ZMVURWDRUIJRTL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.15 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|