C13H15F2N3O — CID 175873657
(R)-1H-benzimidazol-2-yl-[(2S)-5,5-difluorooxan-2-yl]methanamine (PubChem CID 175873657) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is (R)-1H-benzimidazol-2-yl-[(2S)-5,5-difluorooxan-2-yl]methanamine.
| Compound Name | (R)-1H-benzimidazol-2-yl-[(2S)-5,5-difluorooxan-2-yl]methanamine |
|---|---|
| PubChem CID | 175873657 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (R)-1H-benzimidazol-2-yl-[(2S)-5,5-difluorooxan-2-yl]methanamine |
| SMILES | N[C@H](c1nc2ccccc2[nH]1)[C@@H]1CCC(F)(F)CO1 |
| InChI | InChI=1S/C13H15F2N3O/c14-13(15)6-5-10(19-7-13)11(16)12-17-8-3-1-2-4-9(8)18-12/h1-4,10-11H,5-7,16H2,(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | OJXFNHINGMXKEK-QWRGUYRKSA-N |
| XLogP | 2.38 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |