C19H23FN4O2 — CID 175880248
3-[4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-fluoro-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 175880248) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-fluoro-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-fluoro-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175880248 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[4-(2,5-diazabicyclo[2.2.2]octan-2-yl)-7-fluoro-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(F)ccc(N4CC5CCC4CN5)c3C2)C(=O)N1 |
| InChI | InChI=1S/C19H23FN4O2/c20-15-3-4-16(24-8-11-1-2-12(24)7-21-11)14-10-23(9-13(14)15)17-5-6-18(25)22-19(17)26/h3-4,11-12,17,21H,1-2,5-10H2,(H,22,25,26) |
| InChIKey | KOMMYPLQVGXQKA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|