C6H19FN4P2 — CID 175882422
N-[bis(dimethylamino)-fluoro-(phosphanylideneamino)-λ5-phosphanyl]-N-methylmethanamine (PubChem CID 175882422) has the molecular formula C6H19FN4P2 and a molecular weight of 228.19 g/mol. Its IUPAC name is N-[bis(dimethylamino)-fluoro-(phosphanylideneamino)-λ5-phosphanyl]-N-methylmethanamine.
| Compound Name | N-[bis(dimethylamino)-fluoro-(phosphanylideneamino)-λ5-phosphanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 175882422 |
| Molecular Formula | C6H19FN4P2 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-[bis(dimethylamino)-fluoro-(phosphanylideneamino)-λ5-phosphanyl]-N-methylmethanamine |
| SMILES | [H]/P=N/P(F)(N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C6H19FN4P2/c1-9(2)13(7,8-12,10(3)4)11(5)6/h12H,1-6H3 |
| InChIKey | RIPOVDUOSYJVJH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|