C5H7FN2 — CID 175883193
1-deuterio-2-fluoro-4,5-dimethylimidazole (PubChem CID 175883193) has the molecular formula C5H7FN2 and a molecular weight of 115.13 g/mol. Its IUPAC name is 1-deuterio-2-fluoro-4,5-dimethylimidazole.
| Compound Name | 1-deuterio-2-fluoro-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 175883193 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | 1-deuterio-2-fluoro-4,5-dimethylimidazole |
| SMILES | [2H]n1c(F)nc(C)c1C |
| InChI | InChI=1S/C5H7FN2/c1-3-4(2)8-5(6)7-3/h1-2H3,(H,7,8)/i/hD |
| InChIKey | PSFVCMPRFJFPPH-DYCDLGHISA-N |
| XLogP | 1.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |