C36H26F12 — CID 175883342
7-[3,5-bis(trifluoromethyl)phenyl]-5-[3-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 175883342) has the molecular formula C36H26F12 and a molecular weight of 686.58 g/mol. Its IUPAC name is 7-[3,5-bis(trifluoromethyl)phenyl]-5-[3-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-[3,5-bis(trifluoromethyl)phenyl]-5-[3-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 175883342 |
| Molecular Formula | C36H26F12 |
| Molecular Weight | 686.58 g/mol |
| Exact Mass | 686.18 |
| IUPAC Name | 7-[3,5-bis(trifluoromethyl)phenyl]-5-[3-[3,5-bis(trifluoromethyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | FC(F)(F)c1cc(-c2cc3c(c(-c4cc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc5c4CCCC5)c2)CCCC3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H26F12/c37-33(38,39)25-11-23(12-26(17-25)34(40,41)42)21-9-19-5-1-3-7-29(19)31(15-21)32-16-22(10-20-6-2-4-8-30(20)32)24-13-27(35(43,44)45)18-28(14-24)36(46,47)48/h9-18H,1-8H2 |
| InChIKey | OGSADDQCKPODIQ-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.58 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |